tert-Butyl (6-chloropyridin-3-yl)carbamate
| CAS NO.: |
171178-45-3 |
Catalog: |
PRD2218 |
| Formula: |
C10H13ClN2O2 |
Purity: |
95.00% + |
| Molecular Weight: |
228.67 |
Pubchem CID: |
7330593 |
| InChI Key: |
IRHNQVINMHHEIO-UHFFFAOYSA-N |
| Canonical SMILES: |
CC(C)(C)OC(=O)NC1=CN=C(C=C1)Cl |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0