Methyl 2-oxoindoline-4-carboxylate
| CAS NO.: |
90924-46-2 |
Catalog: |
IND922 |
| Formula: |
C10H9NO3 |
Purity: |
97.00% + |
| Molecular Weight: |
191.18 |
Pubchem CID: |
18671947 |
| InChI Key: |
FBKDEECWCACPLH-UHFFFAOYSA-N |
| Canonical SMILES: |
COC(=O)C1=C2CC(=O)NC2=CC=C1 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0