Diethyl 2,5-dithiophen-2-ylbenzene-1,4-dicarboxylate
| CAS NO.: |
915224-39-4 |
Catalog: |
AGR201 |
| Formula: |
C20H18O4S2 |
Purity: |
98.00% + |
| Molecular Weight: |
386.5 |
Pubchem CID: |
59383235 |
| InChI Key: |
ADTLAJNNVGYIPK-UHFFFAOYSA-N |
| Canonical SMILES: |
CCOC(=O)C1=CC(=C(C=C1C2=CC=CS2)C(=O)OCC)C3=CC=CS3 |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0