6,6'-Dimethyl-2,2'-bipyridine
| CAS NO.: |
4411-80-7 |
Catalog: |
PRD0071 |
| Formula: |
C12H12N2 |
Purity: |
98.00% + |
| Molecular Weight: |
184.24 |
Pubchem CID: |
20445 |
| InChI Key: |
OHJPGUSXUGHOGE-UHFFFAOYSA-N |
| Canonical SMILES: |
CC1=NC(=CC=C1)C2=CC=CC(=N2)C |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0