6-Bromo-2,2'-bipyridine
| CAS NO.: |
10495-73-5 |
Catalog: |
PRD0078 |
| Formula: |
C10H7BrN2 |
Purity: |
95.00% + |
| Molecular Weight: |
235.08 |
Pubchem CID: |
11791152 |
| InChI Key: |
NCRIDSGPLISUEU-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=CC=NC(=C1)C2=NC(=CC=C2)Br |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0