5-Bromo-N,4-dimethyl-3-nitropyridin-2-amine
| CAS NO.: |
155790-01-5 |
Catalog: |
PRD2614 |
| Formula: |
C7H8BrN3O2 |
Purity: |
95.00% + |
| Molecular Weight: |
246.06 |
Pubchem CID: |
14929585 |
| InChI Key: |
FUXNDASZVILVLM-UHFFFAOYSA-N |
| Canonical SMILES: |
CC1=C(C(=NC=C1Br)NC)[N+](=O)[O-] |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0