2,6-Dichloroisonicotinic acid
| CAS NO.: |
5398-44-7 |
Catalog: |
PRD3962 |
| Formula: |
C6H3Cl2NO2 |
Purity: |
97.00% + |
| Molecular Weight: |
192 |
Pubchem CID: |
94830 |
| InChI Key: |
SQSYNRCXIZHKAI-UHFFFAOYSA-N |
| Canonical SMILES: |
C1=C(C=C(N=C1Cl)Cl)C(=O)O |
| Storage: |
Store in a cool, dry and well-ventilated area away from incompatible substances. |
원 ₩0